C26H25N3O2 — CID 24624504
N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-9-oxofluorene-2-carboxamide (PubChem CID 24624504) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-9-oxofluorene-2-carboxamide.
| Compound Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-9-oxofluorene-2-carboxamide |
|---|---|
| PubChem CID | 24624504 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-9-oxofluorene-2-carboxamide |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1NC(=O)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H25N3O2/c1-17-15-19(29-13-11-28(2)12-14-29)8-10-24(17)27-26(31)18-7-9-21-20-5-3-4-6-22(20)25(30)23(21)16-18/h3-10,15-16H,11-14H2,1-2H3,(H,27,31) |
| InChIKey | VXSSXIFOWHVNRQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|