C24H24ClNO3 — CID 142824393
2-(2-benzoyl-4-chlorophenoxy)-N-(2-methylphenyl)acetamide;ethane (PubChem CID 142824393) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is 2-(2-benzoyl-4-chlorophenoxy)-N-(2-methylphenyl)acetamide;ethane.
| Compound Name | 2-(2-benzoyl-4-chlorophenoxy)-N-(2-methylphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 142824393 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-(2-benzoyl-4-chlorophenoxy)-N-(2-methylphenyl)acetamide;ethane |
| SMILES | CC.Cc1ccccc1NC(=O)COc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18ClNO3.C2H6/c1-15-7-5-6-10-19(15)24-21(25)14-27-20-12-11-17(23)13-18(20)22(26)16-8-3-2-4-9-16;1-2/h2-13H,14H2,1H3,(H,24,25);1-2H3 |
| InChIKey | RZJQDKHYGZGMQH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |