C15H12Cl2O — CID 43344611
(2,5-dichlorophenyl)-(3,5-dimethylphenyl)methanone (PubChem CID 43344611) has the molecular formula C15H12Cl2O and a molecular weight of 279.17 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(3,5-dimethylphenyl)methanone.
| Compound Name | (2,5-dichlorophenyl)-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 43344611 |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (2,5-dichlorophenyl)-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl2O/c1-9-5-10(2)7-11(6-9)15(18)13-8-12(16)3-4-14(13)17/h3-8H,1-2H3 |
| InChIKey | QMCSXHPCFPOJOZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |