C14H9BrCl2O — CID 81472655
(3-bromo-4-methylphenyl)-(2,5-dichlorophenyl)methanone (PubChem CID 81472655) has the molecular formula C14H9BrCl2O and a molecular weight of 344.04 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-(2,5-dichlorophenyl)methanone.
| Compound Name | (3-bromo-4-methylphenyl)-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 81472655 |
| Molecular Formula | C14H9BrCl2O |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | (3-bromo-4-methylphenyl)-(2,5-dichlorophenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(Cl)ccc2Cl)cc1Br |
| InChI | InChI=1S/C14H9BrCl2O/c1-8-2-3-9(6-12(8)15)14(18)11-7-10(16)4-5-13(11)17/h2-7H,1H3 |
| InChIKey | SHGKNOOAFXSXDX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |