C18H16ClNO — CID 116650948
(6-chloro-1-methylindol-3-yl)-(3,5-dimethylphenyl)methanone (PubChem CID 116650948) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is (6-chloro-1-methylindol-3-yl)-(3,5-dimethylphenyl)methanone.
| Compound Name | (6-chloro-1-methylindol-3-yl)-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 116650948 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (6-chloro-1-methylindol-3-yl)-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)c2cn(C)c3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C18H16ClNO/c1-11-6-12(2)8-13(7-11)18(21)16-10-20(3)17-9-14(19)4-5-15(16)17/h4-10H,1-3H3 |
| InChIKey | PCWNJDKMOBVWET-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |