C17H11F4NO3 — CID 76764759
2-[4-cyano-2-[2-fluoro-5-(trifluoromethyl)phenyl]phenoxy]propanoic acid (PubChem CID 76764759) has the molecular formula C17H11F4NO3 and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-[4-cyano-2-[2-fluoro-5-(trifluoromethyl)phenyl]phenoxy]propanoic acid.
| Compound Name | 2-[4-cyano-2-[2-fluoro-5-(trifluoromethyl)phenyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 76764759 |
| Molecular Formula | C17H11F4NO3 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[4-cyano-2-[2-fluoro-5-(trifluoromethyl)phenyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(C#N)cc1-c1cc(C(F)(F)F)ccc1F)C(=O)O |
| InChI | InChI=1S/C17H11F4NO3/c1-9(16(23)24)25-15-5-2-10(8-22)6-13(15)12-7-11(17(19,20)21)3-4-14(12)18/h2-7,9H,1H3,(H,23,24) |
| InChIKey | GEHKBGCEELTUNC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |