C13H13F3N2O2 — CID 115467877
2-[4-cyano-2-(trifluoromethyl)phenoxy]-N,N-dimethylpropanamide (PubChem CID 115467877) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-[4-cyano-2-(trifluoromethyl)phenoxy]-N,N-dimethylpropanamide.
| Compound Name | 2-[4-cyano-2-(trifluoromethyl)phenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 115467877 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[4-cyano-2-(trifluoromethyl)phenoxy]-N,N-dimethylpropanamide |
| SMILES | CC(Oc1ccc(C#N)cc1C(F)(F)F)C(=O)N(C)C |
| InChI | InChI=1S/C13H13F3N2O2/c1-8(12(19)18(2)3)20-11-5-4-9(7-17)6-10(11)13(14,15)16/h4-6,8H,1-3H3 |
| InChIKey | RMMWUGSARYSXDD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |