C14H12F3NO3 — CID 115467560
methyl 2-[4-cyano-2-(trifluoromethyl)phenoxy]-2-cyclopropylacetate (PubChem CID 115467560) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is methyl 2-[4-cyano-2-(trifluoromethyl)phenoxy]-2-cyclopropylacetate.
| Compound Name | methyl 2-[4-cyano-2-(trifluoromethyl)phenoxy]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 115467560 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 2-[4-cyano-2-(trifluoromethyl)phenoxy]-2-cyclopropylacetate |
| SMILES | COC(=O)C(Oc1ccc(C#N)cc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C14H12F3NO3/c1-20-13(19)12(9-3-4-9)21-11-5-2-8(7-18)6-10(11)14(15,16)17/h2,5-6,9,12H,3-4H2,1H3 |
| InChIKey | HWMOTCJUAKFBER-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |