C14H19F3N2O2 — CID 61389463
2-[4-amino-2-(trifluoromethyl)phenoxy]-N,N-diethylpropanamide (PubChem CID 61389463) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[4-amino-2-(trifluoromethyl)phenoxy]-N,N-diethylpropanamide.
| Compound Name | 2-[4-amino-2-(trifluoromethyl)phenoxy]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 61389463 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[4-amino-2-(trifluoromethyl)phenoxy]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O2/c1-4-19(5-2)13(20)9(3)21-12-7-6-10(18)8-11(12)14(15,16)17/h6-9H,4-5,18H2,1-3H3 |
| InChIKey | ZFBQUNLSVKBSJO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|