C13H18F2N2O2 — CID 63598648
2-(4-amino-2,5-difluorophenoxy)-N,N-diethylpropanamide (PubChem CID 63598648) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-(4-amino-2,5-difluorophenoxy)-N,N-diethylpropanamide.
| Compound Name | 2-(4-amino-2,5-difluorophenoxy)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 63598648 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(4-amino-2,5-difluorophenoxy)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1cc(F)c(N)cc1F |
| InChI | InChI=1S/C13H18F2N2O2/c1-4-17(5-2)13(18)8(3)19-12-7-9(14)11(16)6-10(12)15/h6-8H,4-5,16H2,1-3H3 |
| InChIKey | WVFQYWPYKUAOFL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|