C15H22FNO3 — CID 63067505
N,N-diethyl-2-[5-fluoro-2-(1-hydroxyethyl)phenoxy]propanamide (PubChem CID 63067505) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is N,N-diethyl-2-[5-fluoro-2-(1-hydroxyethyl)phenoxy]propanamide.
| Compound Name | N,N-diethyl-2-[5-fluoro-2-(1-hydroxyethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 63067505 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N,N-diethyl-2-[5-fluoro-2-(1-hydroxyethyl)phenoxy]propanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1cc(F)ccc1C(C)O |
| InChI | InChI=1S/C15H22FNO3/c1-5-17(6-2)15(19)11(4)20-14-9-12(16)7-8-13(14)10(3)18/h7-11,18H,5-6H2,1-4H3 |
| InChIKey | NVJFESJGZDASAX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |