C15H23FN2O2 — CID 63065663
2-[2-(1-aminoethyl)-5-fluorophenoxy]-N,N-diethylpropanamide (PubChem CID 63065663) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[2-(1-aminoethyl)-5-fluorophenoxy]-N,N-diethylpropanamide.
| Compound Name | 2-[2-(1-aminoethyl)-5-fluorophenoxy]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 63065663 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-[2-(1-aminoethyl)-5-fluorophenoxy]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1cc(F)ccc1C(C)N |
| InChI | InChI=1S/C15H23FN2O2/c1-5-18(6-2)15(19)11(4)20-14-9-12(16)7-8-13(14)10(3)17/h7-11H,5-6,17H2,1-4H3 |
| InChIKey | HLFSLSCXRQYVEJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |