C12H16FN3O3 — CID 78935934
2-[2-[(1S)-1-aminoethyl]-5-fluorophenoxy]-N-carbamoylpropanamide (PubChem CID 78935934) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-[2-[(1S)-1-aminoethyl]-5-fluorophenoxy]-N-carbamoylpropanamide.
| Compound Name | 2-[2-[(1S)-1-aminoethyl]-5-fluorophenoxy]-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 78935934 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[2-[(1S)-1-aminoethyl]-5-fluorophenoxy]-N-carbamoylpropanamide |
| SMILES | CC(Oc1cc(F)ccc1[C@H](C)N)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H16FN3O3/c1-6(14)9-4-3-8(13)5-10(9)19-7(2)11(17)16-12(15)18/h3-7H,14H2,1-2H3,(H3,15,16,17,18)/t6-,7?/m0/s1 |
| InChIKey | JZRBSBRBDQQACP-PKPIPKONSA-N |
| XLogP | 0.81 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |