C13H17FN2O4 — CID 63366328
2-[5-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]-N-(methylcarbamoyl)propanamide (PubChem CID 63366328) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[5-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[5-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 63366328 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[5-fluoro-2-[(1R)-1-hydroxyethyl]phenoxy]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Oc1cc(F)ccc1[C@@H](C)O |
| InChI | InChI=1S/C13H17FN2O4/c1-7(17)10-5-4-9(14)6-11(10)20-8(2)12(18)16-13(19)15-3/h4-8,17H,1-3H3,(H2,15,16,18,19)/t7-,8?/m1/s1 |
| InChIKey | DDACTBDJSKGASF-GVHYBUMESA-N |
| XLogP | 1.10 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |