C12H16N2O3 — CID 60625654
N-(methylcarbamoyl)-2-(2-methylphenoxy)propanamide (PubChem CID 60625654) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-(methylcarbamoyl)-2-(2-methylphenoxy)propanamide.
| Compound Name | N-(methylcarbamoyl)-2-(2-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 60625654 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-(methylcarbamoyl)-2-(2-methylphenoxy)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Oc1ccccc1C |
| InChI | InChI=1S/C12H16N2O3/c1-8-6-4-5-7-10(8)17-9(2)11(15)14-12(16)13-3/h4-7,9H,1-3H3,(H2,13,14,15,16) |
| InChIKey | WKJUMHVXDCYCRX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |