C12H15ClN2O3 — CID 8709004
(2R)-2-(4-chloro-2-methylphenoxy)-N-(methylcarbamoyl)propanamide (PubChem CID 8709004) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is (2R)-2-(4-chloro-2-methylphenoxy)-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-(4-chloro-2-methylphenoxy)-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 8709004 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2R)-2-(4-chloro-2-methylphenoxy)-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)Oc1ccc(Cl)cc1C |
| InChI | InChI=1S/C12H15ClN2O3/c1-7-6-9(13)4-5-10(7)18-8(2)11(16)15-12(17)14-3/h4-6,8H,1-3H3,(H2,14,15,16,17)/t8-/m1/s1 |
| InChIKey | LWATUBDLPYUGKK-MRVPVSSYSA-N |
| XLogP | 1.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |