C11H11Cl3N2O3 — CID 8764804
(2S)-N-(methylcarbamoyl)-2-(2,4,5-trichlorophenoxy)propanamide (PubChem CID 8764804) has the molecular formula C11H11Cl3N2O3 and a molecular weight of 325.58 g/mol. Its IUPAC name is (2S)-N-(methylcarbamoyl)-2-(2,4,5-trichlorophenoxy)propanamide.
| Compound Name | (2S)-N-(methylcarbamoyl)-2-(2,4,5-trichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 8764804 |
| Molecular Formula | C11H11Cl3N2O3 |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | (2S)-N-(methylcarbamoyl)-2-(2,4,5-trichlorophenoxy)propanamide |
| SMILES | CNC(=O)NC(=O)[C@H](C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3N2O3/c1-5(10(17)16-11(18)15-2)19-9-4-7(13)6(12)3-8(9)14/h3-5H,1-2H3,(H2,15,16,17,18)/t5-/m0/s1 |
| InChIKey | TVDMCIVQZOULQB-YFKPBYRVSA-N |
| XLogP | 2.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|