C13H17N3O3S — CID 107656615
2-(5-carbamothioyl-2-methylphenoxy)-N-(methylcarbamoyl)propanamide (PubChem CID 107656615) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(5-carbamothioyl-2-methylphenoxy)-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-(5-carbamothioyl-2-methylphenoxy)-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 107656615 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(5-carbamothioyl-2-methylphenoxy)-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Oc1cc(C(N)=S)ccc1C |
| InChI | InChI=1S/C13H17N3O3S/c1-7-4-5-9(11(14)20)6-10(7)19-8(2)12(17)16-13(18)15-3/h4-6,8H,1-3H3,(H2,14,20)(H2,15,16,17,18) |
| InChIKey | YZSJCKMDSSULOB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|