C14H20N2O5 — CID 82003429
2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(methylcarbamoyl)propanamide (PubChem CID 82003429) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 82003429 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[2-[(1R)-1-hydroxyethyl]-5-methoxyphenoxy]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Oc1cc(OC)ccc1[C@@H](C)O |
| InChI | InChI=1S/C14H20N2O5/c1-8(17)11-6-5-10(20-4)7-12(11)21-9(2)13(18)16-14(19)15-3/h5-9,17H,1-4H3,(H2,15,16,18,19)/t8-,9?/m1/s1 |
| InChIKey | PTYJVSYZOROORG-VEDVMXKPSA-N |
| XLogP | 0.97 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |