C16H25NO3 — CID 78930736
N,N-diethyl-2-[2-[(1S)-1-hydroxypropyl]phenoxy]propanamide (PubChem CID 78930736) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N,N-diethyl-2-[2-[(1S)-1-hydroxypropyl]phenoxy]propanamide.
| Compound Name | N,N-diethyl-2-[2-[(1S)-1-hydroxypropyl]phenoxy]propanamide |
|---|---|
| PubChem CID | 78930736 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N,N-diethyl-2-[2-[(1S)-1-hydroxypropyl]phenoxy]propanamide |
| SMILES | CC[C@H](O)c1ccccc1OC(C)C(=O)N(CC)CC |
| InChI | InChI=1S/C16H25NO3/c1-5-14(18)13-10-8-9-11-15(13)20-12(4)16(19)17(6-2)7-3/h8-12,14,18H,5-7H2,1-4H3/t12?,14-/m0/s1 |
| InChIKey | NARDZBVEPPDHPY-PYMCNQPYSA-N |
| XLogP | 2.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |