C17H26N2O2 — CID 43277371
2-[2-[(cyclopropylamino)methyl]phenoxy]-N,N-diethylpropanamide (PubChem CID 43277371) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[2-[(cyclopropylamino)methyl]phenoxy]-N,N-diethylpropanamide.
| Compound Name | 2-[2-[(cyclopropylamino)methyl]phenoxy]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43277371 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-[2-[(cyclopropylamino)methyl]phenoxy]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Oc1ccccc1CNC1CC1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-19(5-2)17(20)13(3)21-16-9-7-6-8-14(16)12-18-15-10-11-15/h6-9,13,15,18H,4-5,10-12H2,1-3H3 |
| InChIKey | JFIUQFWNQBGICJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |