C17H13F4NO4 — CID 70658283
(2S)-2-[2-(4-carbamoyl-3-fluorophenyl)-4-(trifluoromethyl)phenoxy]propanoic acid (PubChem CID 70658283) has the molecular formula C17H13F4NO4 and a molecular weight of 371.29 g/mol. Its IUPAC name is (2S)-2-[2-(4-carbamoyl-3-fluorophenyl)-4-(trifluoromethyl)phenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-(4-carbamoyl-3-fluorophenyl)-4-(trifluoromethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 70658283 |
| Molecular Formula | C17H13F4NO4 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (2S)-2-[2-(4-carbamoyl-3-fluorophenyl)-4-(trifluoromethyl)phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1ccc(C(F)(F)F)cc1-c1ccc(C(N)=O)c(F)c1)C(=O)O |
| InChI | InChI=1S/C17H13F4NO4/c1-8(16(24)25)26-14-5-3-10(17(19,20)21)7-12(14)9-2-4-11(15(22)23)13(18)6-9/h2-8H,1H3,(H2,22,23)(H,24,25)/t8-/m0/s1 |
| InChIKey | LFQSVHHMSLGQAY-QMMMGPOBSA-N |
| XLogP | 3.46 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |