C12H13NO3 — CID 126600902
2-(4-cyano-2-propan-2-ylphenoxy)acetic acid (PubChem CID 126600902) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(4-cyano-2-propan-2-ylphenoxy)acetic acid.
| Compound Name | 2-(4-cyano-2-propan-2-ylphenoxy)acetic acid |
|---|---|
| PubChem CID | 126600902 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(4-cyano-2-propan-2-ylphenoxy)acetic acid |
| SMILES | CC(C)c1cc(C#N)ccc1OCC(=O)O |
| InChI | InChI=1S/C12H13NO3/c1-8(2)10-5-9(6-13)3-4-11(10)16-7-12(14)15/h3-5,8H,7H2,1-2H3,(H,14,15) |
| InChIKey | WLWBOVYBEXEZRM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |