C10H10Cl2O3 — CID 68981824
2-[4-chloro-2-(1-chloroethyl)phenoxy]acetic acid (PubChem CID 68981824) has the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. Its IUPAC name is 2-[4-chloro-2-(1-chloroethyl)phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-(1-chloroethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 68981824 |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-[4-chloro-2-(1-chloroethyl)phenoxy]acetic acid |
| SMILES | CC(Cl)c1cc(Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C10H10Cl2O3/c1-6(11)8-4-7(12)2-3-9(8)15-5-10(13)14/h2-4,6H,5H2,1H3,(H,13,14) |
| InChIKey | KBNYBORGXLFOFO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|