2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid

C11H12BrClO5 — CID 171860864

IUPAC2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid
SMILESO=C(O)COc1cc(Cl)ccc1C(O)C(O)CBr
InChIInChI=1S/C11H12BrClO5/c12-4-8(14)11(17)7-2-1-6(13)3-9(7)18-5-10(15)16/h1-3,8,11,14,17H,4-5H2,(H,15,16)
InChIKeyXWOXLNRTCAEGAJ-UHFFFAOYSA-N
MW339.57 g/mol
LogP1.59
Rot. Bonds6

About 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid

2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid (PubChem CID 171860864) has the molecular formula C11H12BrClO5 and a molecular weight of 339.57 g/mol. Its IUPAC name is 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid
PubChem CID171860864
Molecular FormulaC11H12BrClO5
Molecular Weight339.57 g/mol
Exact Mass337.96
IUPAC Name2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid
SMILESO=C(O)COc1cc(Cl)ccc1C(O)C(O)CBr
InChIInChI=1S/C11H12BrClO5/c12-4-8(14)11(17)7-2-1-6(13)3-9(7)18-5-10(15)16/h1-3,8,11,14,17H,4-5H2,(H,15,16)
InChIKeyXWOXLNRTCAEGAJ-UHFFFAOYSA-N
XLogP1.59
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.57
LogP ≤ 51.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid?
The IUPAC name of 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid (CID 171860864) is 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid.
What is the SMILES notation for 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid?
The canonical SMILES for 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid is O=C(O)COc1cc(Cl)ccc1C(O)C(O)CBr.
What is the InChIKey of 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid?
The InChIKey is XWOXLNRTCAEGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrClO5/c12-4-8(14)11(17)7-2-1-6(13)3-9(7)18-5-10(15)16/h1-3,8,11,14,17H,4-5H2,(H,15,16).
What are the key properties of 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid?
2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid has a molecular weight of 339.57 g/mol, XLogP of 1.59, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid is sourced from PubChem (CID 171860864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).