C11H12BrClO5 — CID 171860864
2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid (PubChem CID 171860864) has the molecular formula C11H12BrClO5 and a molecular weight of 339.57 g/mol. Its IUPAC name is 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid.
| Compound Name | 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 171860864 |
| Molecular Formula | C11H12BrClO5 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 2-[2-(3-bromo-1,2-dihydroxypropyl)-5-chlorophenoxy]acetic acid |
| SMILES | O=C(O)COc1cc(Cl)ccc1C(O)C(O)CBr |
| InChI | InChI=1S/C11H12BrClO5/c12-4-8(14)11(17)7-2-1-6(13)3-9(7)18-5-10(15)16/h1-3,8,11,14,17H,4-5H2,(H,15,16) |
| InChIKey | XWOXLNRTCAEGAJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|