C11H14O5S — CID 170820478
2-[2-(1,2-dihydroxy-3-sulfanylpropyl)phenoxy]acetic acid (PubChem CID 170820478) has the molecular formula C11H14O5S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[2-(1,2-dihydroxy-3-sulfanylpropyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(1,2-dihydroxy-3-sulfanylpropyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 170820478 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[2-(1,2-dihydroxy-3-sulfanylpropyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C(O)C(O)CS |
| InChI | InChI=1S/C11H14O5S/c12-8(6-17)11(15)7-3-1-2-4-9(7)16-5-10(13)14/h1-4,8,11-12,15,17H,5-6H2,(H,13,14) |
| InChIKey | NWLWVDVMNCCZFS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|