C13H18O5 — CID 134353568
2-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]phenoxy]acetic acid (PubChem CID 134353568) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 134353568 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[2-[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]phenoxy]acetic acid |
| SMILES | CC(C)(C)OC(O)c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C13H18O5/c1-13(2,3)18-12(16)9-6-4-5-7-10(9)17-8-11(14)15/h4-7,12,16H,8H2,1-3H3,(H,14,15) |
| InChIKey | VXQQRPADWJUEME-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|