2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid

C12H14O7 — CID 171864656

IUPAC2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid
SMILESCOC(=O)C(O)C(O)c1ccccc1OCC(=O)O
InChIInChI=1S/C12H14O7/c1-18-12(17)11(16)10(15)7-4-2-3-5-8(7)19-6-9(13)14/h2-5,10-11,15-16H,6H2,1H3,(H,13,14)
InChIKeyXTFJYWHDDRZAMI-UHFFFAOYSA-N
MW270.24 g/mol
LogP-0.28
Rot. Bonds6

About 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid

2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid (PubChem CID 171864656) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid
PubChem CID171864656
Molecular FormulaC12H14O7
Molecular Weight270.24 g/mol
Exact Mass270.07
IUPAC Name2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid
SMILESCOC(=O)C(O)C(O)c1ccccc1OCC(=O)O
InChIInChI=1S/C12H14O7/c1-18-12(17)11(16)10(15)7-4-2-3-5-8(7)19-6-9(13)14/h2-5,10-11,15-16H,6H2,1H3,(H,13,14)
InChIKeyXTFJYWHDDRZAMI-UHFFFAOYSA-N
XLogP-0.28
TPSA113.29 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.24
LogP ≤ 5-0.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid?
The IUPAC name of 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid (CID 171864656) is 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid?
The canonical SMILES for 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid is COC(=O)C(O)C(O)c1ccccc1OCC(=O)O.
What is the InChIKey of 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid?
The InChIKey is XTFJYWHDDRZAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-18-12(17)11(16)10(15)7-4-2-3-5-8(7)19-6-9(13)14/h2-5,10-11,15-16H,6H2,1H3,(H,13,14).
What are the key properties of 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid?
2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid has a molecular weight of 270.24 g/mol, XLogP of -0.28, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-dihydroxy-3-methoxy-3-oxopropyl)phenoxy]acetic acid is sourced from PubChem (CID 171864656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).