About 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid
3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid (PubChem CID 170824858) has the molecular formula C11H14N2O6
and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid.
Molecular Properties
| Compound Name | 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid |
| PubChem CID | 170824858 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid |
| SMILES | NNC(=O)COc1ccccc1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C11H14N2O6/c12-13-8(14)5-19-7-4-2-1-3-6(7)9(15)10(16)11(17)18/h1-4,9-10,15-16H,5,12H2,(H,13,14)(H,17,18) |
| InChIKey | XSYBYAZIFSQDJO-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid?
The IUPAC name of 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid (CID 170824858) is 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid.
What is the SMILES notation for 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid?
The canonical SMILES for 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid is NNC(=O)COc1ccccc1C(O)C(O)C(=O)O.
What is the InChIKey of 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid?
The InChIKey is XSYBYAZIFSQDJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O6/c12-13-8(14)5-19-7-4-2-1-3-6(7)9(15)10(16)11(17)18/h1-4,9-10,15-16H,5,12H2,(H,13,14)(H,17,18).
What are the key properties of 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid?
3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid has a molecular weight of 270.24 g/mol, XLogP of -1.47, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-hydrazinyl-2-oxoethoxy)phenyl]-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 170824858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).