C12H19N3O4 — CID 171858840
2-[2-[1,2-dihydroxy-3-(methylamino)propyl]phenoxy]acetohydrazide (PubChem CID 171858840) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[2-[1,2-dihydroxy-3-(methylamino)propyl]phenoxy]acetohydrazide.
| Compound Name | 2-[2-[1,2-dihydroxy-3-(methylamino)propyl]phenoxy]acetohydrazide |
|---|---|
| PubChem CID | 171858840 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[2-[1,2-dihydroxy-3-(methylamino)propyl]phenoxy]acetohydrazide |
| SMILES | CNCC(O)C(O)c1ccccc1OCC(=O)NN |
| InChI | InChI=1S/C12H19N3O4/c1-14-6-9(16)12(18)8-4-2-3-5-10(8)19-7-11(17)15-13/h2-5,9,12,14,16,18H,6-7,13H2,1H3,(H,15,17) |
| InChIKey | YVNHXSNABDZFCI-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|