C12H17ClN2O4 — CID 171894702
2-[2-(4-chloro-1,2-dihydroxybutyl)phenoxy]acetohydrazide (PubChem CID 171894702) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-[2-(4-chloro-1,2-dihydroxybutyl)phenoxy]acetohydrazide.
| Compound Name | 2-[2-(4-chloro-1,2-dihydroxybutyl)phenoxy]acetohydrazide |
|---|---|
| PubChem CID | 171894702 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[2-(4-chloro-1,2-dihydroxybutyl)phenoxy]acetohydrazide |
| SMILES | NNC(=O)COc1ccccc1C(O)C(O)CCCl |
| InChI | InChI=1S/C12H17ClN2O4/c13-6-5-9(16)12(18)8-3-1-2-4-10(8)19-7-11(17)15-14/h1-4,9,12,16,18H,5-7,14H2,(H,15,17) |
| InChIKey | JCYLMSCNXMSIRY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|