C11H17N3O4 — CID 170828919
2-[2-(3-amino-1,2-dihydroxypropyl)phenoxy]acetohydrazide (PubChem CID 170828919) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[2-(3-amino-1,2-dihydroxypropyl)phenoxy]acetohydrazide.
| Compound Name | 2-[2-(3-amino-1,2-dihydroxypropyl)phenoxy]acetohydrazide |
|---|---|
| PubChem CID | 170828919 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-[2-(3-amino-1,2-dihydroxypropyl)phenoxy]acetohydrazide |
| SMILES | NCC(O)C(O)c1ccccc1OCC(=O)NN |
| InChI | InChI=1S/C11H17N3O4/c12-5-8(15)11(17)7-3-1-2-4-9(7)18-6-10(16)14-13/h1-4,8,11,15,17H,5-6,12-13H2,(H,14,16) |
| InChIKey | WAEMWTARAHIGRA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|