2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid

C12H17NO5 — CID 171858557

IUPAC2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid
SMILESCNCC(O)C(O)c1cccc(OC)c1C(=O)O
InChIInChI=1S/C12H17NO5/c1-13-6-8(14)11(15)7-4-3-5-9(18-2)10(7)12(16)17/h3-5,8,11,13-15H,6H2,1-2H3,(H,16,17)
InChIKeyBLDLKJZKWXJGLO-UHFFFAOYSA-N
MW255.27 g/mol
LogP0.01
Rot. Bonds6

About 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid

2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid (PubChem CID 171858557) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid.

Molecular Properties

Compound Name2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid
PubChem CID171858557
Molecular FormulaC12H17NO5
Molecular Weight255.27 g/mol
Exact Mass255.11
IUPAC Name2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid
SMILESCNCC(O)C(O)c1cccc(OC)c1C(=O)O
InChIInChI=1S/C12H17NO5/c1-13-6-8(14)11(15)7-4-3-5-9(18-2)10(7)12(16)17/h3-5,8,11,13-15H,6H2,1-2H3,(H,16,17)
InChIKeyBLDLKJZKWXJGLO-UHFFFAOYSA-N
XLogP0.01
TPSA99.02 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 50.01
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid?
The IUPAC name of 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid (CID 171858557) is 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid.
What is the SMILES notation for 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid?
The canonical SMILES for 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid is CNCC(O)C(O)c1cccc(OC)c1C(=O)O.
What is the InChIKey of 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid?
The InChIKey is BLDLKJZKWXJGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5/c1-13-6-8(14)11(15)7-4-3-5-9(18-2)10(7)12(16)17/h3-5,8,11,13-15H,6H2,1-2H3,(H,16,17).
What are the key properties of 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid?
2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid has a molecular weight of 255.27 g/mol, XLogP of 0.01, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,2-dihydroxy-3-(methylamino)propyl]-6-methoxybenzoic acid is sourced from PubChem (CID 171858557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).