C17H16O5 — CID 171865066
methyl 3-(2-benzoylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171865066) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl 3-(2-benzoylphenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(2-benzoylphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865066 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 3-(2-benzoylphenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O5/c1-22-17(21)16(20)15(19)13-10-6-5-9-12(13)14(18)11-7-3-2-4-8-11/h2-10,15-16,19-20H,1H3 |
| InChIKey | CVWZRXSQHGWMEV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |