C10H11NO6 — CID 90019008
methyl (2S,3R)-2,3-dihydroxy-3-(2-nitrophenyl)propanoate (PubChem CID 90019008) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is methyl (2S,3R)-2,3-dihydroxy-3-(2-nitrophenyl)propanoate.
| Compound Name | methyl (2S,3R)-2,3-dihydroxy-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 90019008 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | methyl (2S,3R)-2,3-dihydroxy-3-(2-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11NO6/c1-17-10(14)9(13)8(12)6-4-2-3-5-7(6)11(15)16/h2-5,8-9,12-13H,1H3/t8-,9+/m1/s1 |
| InChIKey | UPADPLKIJUDVKR-BDAKNGLRSA-N |
| XLogP | 0.16 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|