C11H15N2O5+ — CID 7331741
[(2R,3R)-1-ethoxy-3-hydroxy-3-(2-nitrophenyl)-1-oxopropan-2-yl]azanium (PubChem CID 7331741) has the molecular formula C11H15N2O5+ and a molecular weight of 255.25 g/mol. Its IUPAC name is [(2R,3R)-1-ethoxy-3-hydroxy-3-(2-nitrophenyl)-1-oxopropan-2-yl]azanium.
| Compound Name | [(2R,3R)-1-ethoxy-3-hydroxy-3-(2-nitrophenyl)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 7331741 |
| Molecular Formula | C11H15N2O5+ |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | [(2R,3R)-1-ethoxy-3-hydroxy-3-(2-nitrophenyl)-1-oxopropan-2-yl]azanium |
| SMILES | CCOC(=O)[C@H]([NH3+])[C@H](O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N2O5/c1-2-18-11(15)9(12)10(14)7-5-3-4-6-8(7)13(16)17/h3-6,9-10,14H,2,12H2,1H3/p+1/t9-,10-/m1/s1 |
| InChIKey | SRHXLTLYSOXDQI-NXEZZACHSA-O |
| XLogP | -0.20 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|