C10H11NO7 — CID 171864555
methyl 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanoate (PubChem CID 171864555) has the molecular formula C10H11NO7 and a molecular weight of 257.20 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 171864555 |
| Molecular Formula | C10H11NO7 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11NO7/c1-18-10(15)9(14)8(13)6-3-2-5(12)4-7(6)11(16)17/h2-4,8-9,12-14H,1H3 |
| InChIKey | AVLWSYGIBWPVOO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 130.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|