C9H8N2O5 — CID 171870730
2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanenitrile (PubChem CID 171870730) has the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanenitrile |
|---|---|
| PubChem CID | 171870730 |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2,3-dihydroxy-3-(4-hydroxy-2-nitrophenyl)propanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O5/c10-4-8(13)9(14)6-2-1-5(12)3-7(6)11(15)16/h1-3,8-9,12-14H |
| InChIKey | MJGDPYYYMYKRKH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|