C9H8FN3O4 — CID 171870859
3-(2-amino-5-fluoro-3-nitrophenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870859) has the molecular formula C9H8FN3O4 and a molecular weight of 241.18 g/mol. Its IUPAC name is 3-(2-amino-5-fluoro-3-nitrophenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(2-amino-5-fluoro-3-nitrophenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870859 |
| Molecular Formula | C9H8FN3O4 |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 3-(2-amino-5-fluoro-3-nitrophenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cc(F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C9H8FN3O4/c10-4-1-5(9(15)7(14)3-11)8(12)6(2-4)13(16)17/h1-2,7,9,14-15H,12H2 |
| InChIKey | MDJNFDVGXKUESH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|