C9H11ClN2O5 — CID 170818467
1-(2-amino-5-chloro-3-nitrophenyl)propane-1,2,3-triol (PubChem CID 170818467) has the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-nitrophenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-amino-5-chloro-3-nitrophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818467 |
| Molecular Formula | C9H11ClN2O5 |
| Molecular Weight | 262.65 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(2-amino-5-chloro-3-nitrophenyl)propane-1,2,3-triol |
| SMILES | Nc1c(C(O)C(O)CO)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN2O5/c10-4-1-5(9(15)7(14)3-13)8(11)6(2-4)12(16)17/h1-2,7,9,13-15H,3,11H2 |
| InChIKey | BELBHQZZUTWKAX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.65 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|