C9H10BrNO5 — CID 170818974
1-(4-bromo-2-nitrophenyl)propane-1,2,3-triol (PubChem CID 170818974) has the molecular formula C9H10BrNO5 and a molecular weight of 292.08 g/mol. Its IUPAC name is 1-(4-bromo-2-nitrophenyl)propane-1,2,3-triol.
| Compound Name | 1-(4-bromo-2-nitrophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818974 |
| Molecular Formula | C9H10BrNO5 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 1-(4-bromo-2-nitrophenyl)propane-1,2,3-triol |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1C(O)C(O)CO |
| InChI | InChI=1S/C9H10BrNO5/c10-5-1-2-6(7(3-5)11(15)16)9(14)8(13)4-12/h1-3,8-9,12-14H,4H2 |
| InChIKey | YSGYMLOGZIUNCO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|