C10H11ClN2O5 — CID 171899617
4-(4-chloro-2-nitrophenyl)-3,4-dihydroxybutanamide (PubChem CID 171899617) has the molecular formula C10H11ClN2O5 and a molecular weight of 274.66 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(4-chloro-2-nitrophenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899617 |
| Molecular Formula | C10H11ClN2O5 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-(4-chloro-2-nitrophenyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11ClN2O5/c11-5-1-2-6(7(3-5)13(17)18)10(16)8(14)4-9(12)15/h1-3,8,10,14,16H,4H2,(H2,12,15) |
| InChIKey | ABDHVVBSCDSJSJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|