C13H18N2O6 — CID 171898019
ethyl 4-(2-amino-5-methyl-3-nitrophenyl)-3,4-dihydroxybutanoate (PubChem CID 171898019) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl 4-(2-amino-5-methyl-3-nitrophenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(2-amino-5-methyl-3-nitrophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898019 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | ethyl 4-(2-amino-5-methyl-3-nitrophenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(C)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C13H18N2O6/c1-3-21-11(17)6-10(16)13(18)8-4-7(2)5-9(12(8)14)15(19)20/h4-5,10,13,16,18H,3,6,14H2,1-2H3 |
| InChIKey | RGZSIIVSHITDRB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|