C13H17NO6 — CID 171897848
5-amino-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)benzoic acid (PubChem CID 171897848) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 5-amino-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)benzoic acid.
| Compound Name | 5-amino-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)benzoic acid |
|---|---|
| PubChem CID | 171897848 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-amino-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)benzoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C13H17NO6/c1-2-20-11(16)6-10(15)12(17)8-4-3-7(14)5-9(8)13(18)19/h3-5,10,12,15,17H,2,6,14H2,1H3,(H,18,19) |
| InChIKey | WTACOEKGYPYYDU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|