C13H16F3NO5 — CID 171898311
ethyl 4-[5-amino-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate (PubChem CID 171898311) has the molecular formula C13H16F3NO5 and a molecular weight of 323.27 g/mol. Its IUPAC name is ethyl 4-[5-amino-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-[5-amino-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898311 |
| Molecular Formula | C13H16F3NO5 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | ethyl 4-[5-amino-2-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(N)ccc1OC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO5/c1-2-21-11(19)6-9(18)12(20)8-5-7(17)3-4-10(8)22-13(14,15)16/h3-5,9,12,18,20H,2,6,17H2,1H3 |
| InChIKey | DIPJWCPSPIJGAI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|