C16H25NO4 — CID 171898039
ethyl 4-(2-amino-5-tert-butylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171898039) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl 4-(2-amino-5-tert-butylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(2-amino-5-tert-butylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898039 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethyl 4-(2-amino-5-tert-butylphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(C(C)(C)C)ccc1N |
| InChI | InChI=1S/C16H25NO4/c1-5-21-14(19)9-13(18)15(20)11-8-10(16(2,3)4)6-7-12(11)17/h6-8,13,15,18,20H,5,9,17H2,1-4H3 |
| InChIKey | WRDQDKOPHGDHIX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|