C12H17NO6S — CID 171897814
ethyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate (PubChem CID 171897814) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate |
|---|---|
| PubChem CID | 171897814 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(2-sulfamoylphenyl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H17NO6S/c1-2-19-11(15)7-9(14)12(16)8-5-3-4-6-10(8)20(13,17)18/h3-6,9,12,14,16H,2,7H2,1H3,(H2,13,17,18) |
| InChIKey | GQMWKIKAUCFQPC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |