C13H15NO4S — CID 171897393
ethyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate (PubChem CID 171897393) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate |
|---|---|
| PubChem CID | 171897393 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(2-isothiocyanatophenyl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccccc1N=C=S |
| InChI | InChI=1S/C13H15NO4S/c1-2-18-12(16)7-11(15)13(17)9-5-3-4-6-10(9)14-8-19/h3-6,11,13,15,17H,2,7H2,1H3 |
| InChIKey | VMCOCFBMYFHUBV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|