C15H17NO5 — CID 171898085
ethyl 4-[2-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutanoate (PubChem CID 171898085) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is ethyl 4-[2-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-[2-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898085 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl 4-[2-(2-cyanoacetyl)phenyl]-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccccc1C(=O)CC#N |
| InChI | InChI=1S/C15H17NO5/c1-2-21-14(19)9-13(18)15(20)11-6-4-3-5-10(11)12(17)7-8-16/h3-6,13,15,18,20H,2,7,9H2,1H3 |
| InChIKey | IJNMHLSCAQSBCN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |