C17H18O6 — CID 171898352
5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)naphthalene-1-carboxylic acid (PubChem CID 171898352) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)naphthalene-1-carboxylic acid.
| Compound Name | 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 171898352 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)naphthalene-1-carboxylic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1cccc2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C17H18O6/c1-2-23-15(19)9-14(18)16(20)12-7-3-6-11-10(12)5-4-8-13(11)17(21)22/h3-8,14,16,18,20H,2,9H2,1H3,(H,21,22) |
| InChIKey | KNBPPUKVHXZAPY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |